CAS 1936076-04-8 is the registry number for 4-(3-Methoxy-1,2-thiazol-5-yl)benzaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(3-methoxy-1,2-thiazol-5-yl)benzaldehyde (CAS 1936076-04-8) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 4-(3-methoxy-1,2-thiazol-5-yl)benzaldehyde. InChIKey: NPEHVOJNVLWXIL-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 4-(3-methoxy-1,2-thiazol-5-yl)benzaldehyde |
| InChIKey | NPEHVOJNVLWXIL-UHFFFAOYSA-N |
| SMILES | COC1=NSC(=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)