CAS 193693-64-0 appears in our catalog under these names: Fmoc–azetidine–3–carboxylic acid, Fmoc-3Aze-OH, 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]azetidine-3-carboxylic Acid, >98.0%(HPLC)(N), Fmoc-azetidine-3-carboxylic acid 95%, 1-Fmoc-azetidine-3-carboxylic acid, 95%, 95%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 5g, 25g, 1g, 500g, 100g, 10g.
1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-3-carboxylic acid (CAS 193693-64-0) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-3-carboxylic acid. InChIKey: QDEJCUHGSHSYQH-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-3-carboxylic acid |
| InChIKey | QDEJCUHGSHSYQH-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)