CAS 78685-70-8 is the registry number for (E)-2-Styrylbenzo[d]oxazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(E)-2-phenylethenyl]-1,3-benzoxazole (CAS 78685-70-8) is a chemical compound with the molecular formula C15H11NO and a molecular weight of 221.25 g/mol. IUPAC name: 2-[(E)-2-phenylethenyl]-1,3-benzoxazole. InChIKey: GJFNNZBYCMUAHY-ZHACJKMWSA-N.
| Molecular formula | C15H11NO |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2-[(E)-2-phenylethenyl]-1,3-benzoxazole |
| InChIKey | GJFNNZBYCMUAHY-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=NC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)