CAS 19473-98-4 is the registry number for (2Z)-3-Phenyl-n'-[(2e)-3-phenylprop-2-enoyl]prop-2-enehydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z)-3-phenyl-N'-[(E)-3-phenylprop-2-enoyl]prop-2-enehydrazide (CAS 19473-98-4) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: (Z)-3-phenyl-N'-[(E)-3-phenylprop-2-enoyl]prop-2-enehydrazide. InChIKey: POTPVJOBCXVCJE-HEEUSZRZSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | (Z)-3-phenyl-N'-[(E)-3-phenylprop-2-enoyl]prop-2-enehydrazide |
| InChIKey | POTPVJOBCXVCJE-HEEUSZRZSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NNC(=O)/C=C\C2=CC=CC=C2 |
Computed by PubChem (NCBI)