Products 194804-90-5
CAS 194804-90-5 appears in our catalog under these names: 4–Bromo–2–fluoro–3–methylbenzoic acid, 4-Bromo-2-fluoro-3-methylbenzoic acid, 4-Bromo-2-fluoro-3-methylbenzoic acid 95%, 4-Bromo-2-fluoro-3-methylbenzoic acid, 95%, 95%, 4-Bromo-2-fluoro-3-methylbenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 2,5g, 100mg, 25g, 10g.
4-bromo-2-fluoro-3-methylbenzoic acid (CAS 194804-90-5) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 4-bromo-2-fluoro-3-methylbenzoic acid. InChIKey: PIMDCUNZRUXGME-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-methylbenzoic acid |
| InChIKey | PIMDCUNZRUXGME-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)C(=O)O)Br |
Computed by PubChem (NCBI)