CAS 1949816-38-9 appears in our catalog under these names: 6,8-Dibromo-1,2,3,4-tetrahydro-1,5-naphthyridine, 95%, 6,8-Dibromo-1,2,3,4-tetrahydro-1,5-naphthyridine, 6,8-Dibromo-1,2,3,4-tetrahydro-1,5-naphthyridine, 98%, 98%, 6,8-dibromo-1,2,3,4-tetrahydro-1,5-naphthyridine, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 50mg, 0,5g, 100mg, 500mg.
6,8-dibromo-1,2,3,4-tetrahydro-1,5-naphthyridine (CAS 1949816-38-9) is a chemical compound with the molecular formula C8H8Br2N2 and a molecular weight of 291.97 g/mol. IUPAC name: 6,8-dibromo-1,2,3,4-tetrahydro-1,5-naphthyridine. InChIKey: SOCSRDXBNUJLNM-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2 |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 6,8-dibromo-1,2,3,4-tetrahydro-1,5-naphthyridine |
| InChIKey | SOCSRDXBNUJLNM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=N2)Br)Br)NC1 |
Computed by PubChem (NCBI)