CAS 264276-18-8 appears in our catalog under these names: 4–(Bromomethyl)–1H–indazole hydrobromide, 4-(Bromomethyl)-1H-indazole hydrobromide, 95%, 95%, 4-(Bromomethyl)-1H-indazole hydrobromide, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(bromomethyl)-1H-indazole;hydrobromide (CAS 264276-18-8) is a chemical compound with the molecular formula C8H8Br2N2 and a molecular weight of 291.97 g/mol. IUPAC name: 4-(bromomethyl)-1H-indazole;hydrobromide. InChIKey: NXPNEYAWBKBBMP-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2 |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 4-(bromomethyl)-1H-indazole;hydrobromide |
| InChIKey | NXPNEYAWBKBBMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NNC2=C1)CBr.Br |
Computed by PubChem (NCBI)