CAS 74420-43-2 is the registry number for 5-Bromo-3-methylimidazo[1,2-a]pyridine hydrobromide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-bromo-3-methylimidazo[1,2-a]pyridine;hydrobromide (CAS 74420-43-2) is a chemical compound with the molecular formula C8H8Br2N2 and a molecular weight of 291.97 g/mol. IUPAC name: 5-bromo-3-methylimidazo[1,2-a]pyridine;hydrobromide. InChIKey: LGYNQHZVIJNUIX-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2 |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 5-bromo-3-methylimidazo[1,2-a]pyridine;hydrobromide |
| InChIKey | LGYNQHZVIJNUIX-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2N1C(=CC=C2)Br.Br |
Computed by PubChem (NCBI)