CAS 2089315-51-3 appears in our catalog under these names: 5-(Bromomethyl)imidazo[1,2-a]pyridine hydrobromide, 97+%, 97+%, 5-(Bromomethyl)imidazo[1,2-a]pyridine hydrobromide, 97+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-(bromomethyl)imidazo[1,2-a]pyridine;hydrobromide (CAS 2089315-51-3) is a chemical compound with the molecular formula C8H8Br2N2 and a molecular weight of 291.97 g/mol. IUPAC name: 5-(bromomethyl)imidazo[1,2-a]pyridine;hydrobromide. InChIKey: NYOGSZRWDYEMIY-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2 |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 5-(bromomethyl)imidazo[1,2-a]pyridine;hydrobromide |
| InChIKey | NYOGSZRWDYEMIY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2C(=C1)CBr.Br |
Computed by PubChem (NCBI)