Products 368426-63-5

CAS 368426-63-5 is the registry number for 6-(Bromomethyl)-1H-indazole hydrobromide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

6-(bromomethyl)-1H-indazole;hydrobromide (CAS 368426-63-5) is a chemical compound with the molecular formula C8H8Br2N2 and a molecular weight of 291.97 g/mol. IUPAC name: 6-(bromomethyl)-1H-indazole;hydrobromide. InChIKey: DTGUIYRXOJYJLA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Br2N2
Molecular weight291.97 g/mol
IUPAC name6-(bromomethyl)-1H-indazole;hydrobromide
InChIKeyDTGUIYRXOJYJLA-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1CBr)NN=C2.Br

Computed by PubChem (NCBI)