Products 2409818-20-6
CAS 2409818-20-6 appears in our catalog under these names: 5,8-Dibromo-1,2,3,4-tetrahydroquinoxaline, 98%, 5,8-DIBROMO-1,2,3,4-TETRAHYDROQUINOXALINE, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5,8-dibromo-1,2,3,4-tetrahydroquinoxaline (CAS 2409818-20-6) is a chemical compound with the molecular formula C8H8Br2N2 and a molecular weight of 291.97 g/mol. IUPAC name: 5,8-dibromo-1,2,3,4-tetrahydroquinoxaline. InChIKey: HQVCAXNJFZRBNB-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2 |
|---|---|
| Molecular weight | 291.97 g/mol |
| IUPAC name | 5,8-dibromo-1,2,3,4-tetrahydroquinoxaline |
| InChIKey | HQVCAXNJFZRBNB-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=CC(=C2N1)Br)Br |
Computed by PubChem (NCBI)