Products 1951439-00-1
CAS 1951439-00-1 appears in our catalog under these names: 1-(2-(difluoromethyl)phenyl)methanamine hydrochloride, 2-Difluoromethyl-benzylamine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 250mg, 2,5g, 1g.
[2-(difluoromethyl)phenyl]methanamine;hydrochloride (CAS 1951439-00-1) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: [2-(difluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: LAGFWDPCDMYYCJ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | [2-(difluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | LAGFWDPCDMYYCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)C(F)F.Cl |
Computed by PubChem (NCBI)