CAS 20806-80-8 is the registry number for (S)-2-((2,5-Dimethoxybenzyl)amino)-2-phenylacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(2,5-dimethoxyphenyl)methylamino]-2-phenylacetic acid (CAS 20806-80-8) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: (2S)-2-[(2,5-dimethoxyphenyl)methylamino]-2-phenylacetic acid. InChIKey: MFJUZYGFOJTQDH-INIZCTEOSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | (2S)-2-[(2,5-dimethoxyphenyl)methylamino]-2-phenylacetic acid |
| InChIKey | MFJUZYGFOJTQDH-INIZCTEOSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)CN[C@@H](C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)