CAS 195370-52-6 is the registry number for Tranexamic Acid Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
4-(dichloromethyl)benzamide (CAS 195370-52-6) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 4-(dichloromethyl)benzamide. InChIKey: IHUUTSBGRXYRMI-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 4-(dichloromethyl)benzamide |
| InChIKey | IHUUTSBGRXYRMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)