CAS 1955522-63-0 appears in our catalog under these names: 5,8-Difluoro-3,4-dihydro-2H-1,4-benzoxazine hydrochloride, 95%, 5,8-Difluoro-3,4-dihydro-2H-1,4-benzoxazine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5,8-difluoro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CAS 1955522-63-0) is a chemical compound with the molecular formula C8H8ClF2NO and a molecular weight of 207.60 g/mol. IUPAC name: 5,8-difluoro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride. InChIKey: KEJDIYCQBBGLKN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO |
|---|---|
| Molecular weight | 207.60 g/mol |
| IUPAC name | 5,8-difluoro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| InChIKey | KEJDIYCQBBGLKN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2N1)F)F.Cl |
Computed by PubChem (NCBI)