CAS 937606-80-9 appears in our catalog under these names: 3-Chloro-4-(2,2-difluoroethoxy)aniline, 97%, 3-Chloro-4-(2,2-difluoroethoxy)aniline, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
3-chloro-4-(2,2-difluoroethoxy)aniline (CAS 937606-80-9) is a chemical compound with the molecular formula C8H8ClF2NO and a molecular weight of 207.60 g/mol. IUPAC name: 3-chloro-4-(2,2-difluoroethoxy)aniline. InChIKey: GBJMFEWPRHZXOW-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO |
|---|---|
| Molecular weight | 207.60 g/mol |
| IUPAC name | 3-chloro-4-(2,2-difluoroethoxy)aniline |
| InChIKey | GBJMFEWPRHZXOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)OCC(F)F |
Computed by PubChem (NCBI)