CAS 1955531-90-4 appears in our catalog under these names: 3-Amino-3-(pyridin-4-yl)propanoic acid dihydrochloride, 97%, 3-Amino-3-(pyridin-4-yl)propanoic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-amino-3-pyridin-4-ylpropanoic acid;dihydrochloride (CAS 1955531-90-4) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: 3-amino-3-pyridin-4-ylpropanoic acid;dihydrochloride. InChIKey: DDHUXAOSXIGPFO-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 3-amino-3-pyridin-4-ylpropanoic acid;dihydrochloride |
| InChIKey | DDHUXAOSXIGPFO-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C(CC(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)