Products 1956436-66-0
CAS 1956436-66-0 appears in our catalog under these names: (R)-7-Chloroisochroman-4-amine hydrochloride, 95%, (4R)-7-CHLORO-3,4-DIHYDRO-1H-2-BENZOPYRAN-4-AMINE HYDROCHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(4R)-7-chloro-3,4-dihydro-1H-isochromen-4-amine;hydrochloride (CAS 1956436-66-0) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: (4R)-7-chloro-3,4-dihydro-1H-isochromen-4-amine;hydrochloride. InChIKey: XQERWIHJIUJSHF-FVGYRXGTSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | (4R)-7-chloro-3,4-dihydro-1H-isochromen-4-amine;hydrochloride |
| InChIKey | XQERWIHJIUJSHF-FVGYRXGTSA-N |
| SMILES | C1[C@@H](C2=C(CO1)C=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)