CAS 1956437-80-1 appears in our catalog under these names: (S)–1–(2,6–Dimethoxyphenyl)ethanamine hydrochloride, (S)-1-(2,6-Dimethoxyphenyl)ethanamine hydrochloride, 95%, (S)-1-(2,6-Dimethoxyphenyl)ethanamine hydrochloride, 97%, (S)-1-(2,6-Dimethoxyphenyl)ethanamine hydrochloride, 97%, 97%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(2,6-dimethoxyphenyl)ethanamine;hydrochloride (CAS 1956437-80-1) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (1S)-1-(2,6-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: UKXUVOAXVRXVQT-FJXQXJEOSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (1S)-1-(2,6-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | UKXUVOAXVRXVQT-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=C(C=CC=C1OC)OC)N.Cl |
Computed by PubChem (NCBI)