CAS 889858-12-2 appears in our catalog under these names: tert-Butyl 4-Bromo-2-fluorobenzoate, tert-Butyl 4-bromo-2-fluorobenzoate, 98%, tert-Butyl 4-Bromo-2-fluorobenzoate, 98%, 98%. Offered by: TRC, Biosynth, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100g, 250g, 500g, 10g, 25g.
Tert-butyl 4-bromo-2-fluorobenzoate (CAS 889858-12-2) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 4-bromo-2-fluorobenzoate. InChIKey: ZPGZHSAOCVWZMR-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 4-bromo-2-fluorobenzoate |
| InChIKey | ZPGZHSAOCVWZMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)