Products 1961272-45-6
CAS 1961272-45-6 is the registry number for 6-MOMIPP. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(6-methoxy-2-methyl-1H-indol-3-yl)-1-pyridin-4-ylprop-2-en-1-one (CAS 1961272-45-6) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: (E)-3-(6-methoxy-2-methyl-1H-indol-3-yl)-1-pyridin-4-ylprop-2-en-1-one. InChIKey: RPNPISGFLNFEFU-AATRIKPKSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | (E)-3-(6-methoxy-2-methyl-1H-indol-3-yl)-1-pyridin-4-ylprop-2-en-1-one |
| InChIKey | RPNPISGFLNFEFU-AATRIKPKSA-N |
| SMILES | CC1=C(C2=C(N1)C=C(C=C2)OC)/C=C/C(=O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)