CAS 196206-09-4 appears in our catalog under these names: methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-2-cyclopentylacetate, 95%, methyl (2S)-2-{((tert-butoxy)carbonyl)amino}-2-cyclopentylacetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl (2S)-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CAS 196206-09-4) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: methyl (2S)-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate. InChIKey: URZBRYIUDLUPSN-JTQLQIEISA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | methyl (2S)-2-cyclopentyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| InChIKey | URZBRYIUDLUPSN-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1CCCC1)C(=O)OC |
Computed by PubChem (NCBI)