CAS 1965310-24-0 appears in our catalog under these names: Paracetamol EP Impurity M HCl , 4,4'-Iminodiphenol hydrochloride, 97%, 97%, 4,4'-Iminodiphenol hydrochloride, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 1g, 5g, 10g.
4-(4-hydroxyanilino)phenol;hydrochloride (CAS 1965310-24-0) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 4-(4-hydroxyanilino)phenol;hydrochloride. InChIKey: QHTSGASMDKSUHO-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 4-(4-hydroxyanilino)phenol;hydrochloride |
| InChIKey | QHTSGASMDKSUHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CC=C(C=C2)O)O.Cl |
Computed by PubChem (NCBI)