CAS 19654-32-1 appears in our catalog under these names: 2,4-Dichlorobenzylisocyanate, 98%, 2，4–Dichlorobenzyl Isocyanate. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg.
2,4-dichloro-1-(isocyanatomethyl)benzene (CAS 19654-32-1) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 2,4-dichloro-1-(isocyanatomethyl)benzene. InChIKey: FUIUATRKBRZCQD-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 2,4-dichloro-1-(isocyanatomethyl)benzene |
| InChIKey | FUIUATRKBRZCQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CN=C=O |
Computed by PubChem (NCBI)