CAS 196934-20-0 appears in our catalog under these names: tert-Butyl 4-(trifluoromethyl)benzoate, 95%, tert-Butyl 4-(trifluoromethyl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Tert-butyl 4-(trifluoromethyl)benzoate (CAS 196934-20-0) is a chemical compound with the molecular formula C12H13F3O2 and a molecular weight of 246.22 g/mol. IUPAC name: tert-butyl 4-(trifluoromethyl)benzoate. InChIKey: PIEAJQRJRYBARO-UHFFFAOYSA-N.
| Molecular formula | C12H13F3O2 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | tert-butyl 4-(trifluoromethyl)benzoate |
| InChIKey | PIEAJQRJRYBARO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)