Products 88623-81-8
CAS 88623-81-8 is the registry number for (2E)-3-[3,4-Bis(acetyloxy)phenyl]-2-propenoic acid, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(E)-3-(3,4-diacetyloxyphenyl)prop-2-enoic acid (CAS 88623-81-8) is a chemical compound with the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. IUPAC name: (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoic acid. InChIKey: ZDIYGBWFISUTHI-GQCTYLIASA-N.
| Molecular formula | C13H12O6 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoic acid |
| InChIKey | ZDIYGBWFISUTHI-GQCTYLIASA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)/C=C/C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
(E)-Caffeic Acid Diacetate, 3-[3,4-Bis(acetyloxy)phenyl]-2-propenoic Acid, (2E)-3-[3,4-bis(acetyloxy)phenyl]prop-2-enoic acid, (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoic acid, 3-(3,4-Diacetoxyphenyl)acrylic acid, 2-Propenoic acid, 3-[3,4-bis(acetyloxy)phenyl]-, (E)-, 3-(3,4-Bis(acetoxy)phenyl)acrylic acid, (E)-3-(3,4-Diacetoxyphenyl)acrylic acid, 3-(3,4-diacetoxyphenyl)-2-propenoic acid, 2-Propenoic acid, 3-[3,4-bis(acetyloxy)phenyl]-