CAS 1983191-81-6 is the registry number for Ethyl 2-[(4-bromophenyl)amino]-2-thioxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(4-bromoanilino)-2-sulfanylideneacetate (CAS 1983191-81-6) is a chemical compound with the molecular formula C10H10BrNO2S and a molecular weight of 288.16 g/mol. IUPAC name: ethyl 2-(4-bromoanilino)-2-sulfanylideneacetate. InChIKey: JYMCPRZKLWNRQH-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2S |
|---|---|
| Molecular weight | 288.16 g/mol |
| IUPAC name | ethyl 2-(4-bromoanilino)-2-sulfanylideneacetate |
| InChIKey | JYMCPRZKLWNRQH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=S)NC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)