CAS 1912446-80-0 is the registry number for 6-Bromo-1-(vinylsulfonyl)indoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-1-ethenylsulfonyl-2,3-dihydroindole (CAS 1912446-80-0) is a chemical compound with the molecular formula C10H10BrNO2S and a molecular weight of 288.16 g/mol. IUPAC name: 6-bromo-1-ethenylsulfonyl-2,3-dihydroindole. InChIKey: YKMCAKOKAFDBPK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2S |
|---|---|
| Molecular weight | 288.16 g/mol |
| IUPAC name | 6-bromo-1-ethenylsulfonyl-2,3-dihydroindole |
| InChIKey | YKMCAKOKAFDBPK-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)N1CCC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)