Products 69570-83-8
CAS 69570-83-8 appears in our catalog under these names: 2-(4-Bromophenyl)thiazolidine-4-carboxylic acid, 95%, 2-(4-Bromophenyl)thiazolidine-4-carboxylic acid, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g, 100g, 250g.
2-(4-bromophenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 69570-83-8) is a chemical compound with the molecular formula C10H10BrNO2S and a molecular weight of 288.16 g/mol. IUPAC name: 2-(4-bromophenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: TYLJHTCYCWHWRG-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2S |
|---|---|
| Molecular weight | 288.16 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | TYLJHTCYCWHWRG-UHFFFAOYSA-N |
| SMILES | C1C(NC(S1)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)