Products 1624261-11-5

CAS 1624261-11-5 is the registry number for O-(5-Bromo-2-formylphenyl) dimethylcarbamothioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

O-(5-bromo-2-formylphenyl) N,N-dimethylcarbamothioate (CAS 1624261-11-5) is a chemical compound with the molecular formula C10H10BrNO2S and a molecular weight of 288.16 g/mol. IUPAC name: O-(5-bromo-2-formylphenyl) N,N-dimethylcarbamothioate. InChIKey: WEZSGAAICNHEKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10BrNO2S
Molecular weight288.16 g/mol
IUPAC nameO-(5-bromo-2-formylphenyl) N,N-dimethylcarbamothioate
InChIKeyWEZSGAAICNHEKZ-UHFFFAOYSA-N
SMILESCN(C)C(=S)OC1=C(C=CC(=C1)Br)C=O

Computed by PubChem (NCBI)