Products 294866-41-4

CAS 294866-41-4 is the registry number for 2-(4-Bromophenyl)-1,3-thiazolane-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

(4R)-2-(4-bromophenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 294866-41-4) is a chemical compound with the molecular formula C10H10BrNO2S and a molecular weight of 288.16 g/mol. IUPAC name: (4R)-2-(4-bromophenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: TYLJHTCYCWHWRG-IENPIDJESA-N.

Identity
Molecular formulaC10H10BrNO2S
Molecular weight288.16 g/mol
IUPAC name(4R)-2-(4-bromophenyl)-1,3-thiazolidine-4-carboxylic acid
InChIKeyTYLJHTCYCWHWRG-IENPIDJESA-N
SMILESC1[C@H](NC(S1)C2=CC=C(C=C2)Br)C(=O)O

Computed by PubChem (NCBI)