CAS 294866-41-4 is the registry number for 2-(4-Bromophenyl)-1,3-thiazolane-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(4R)-2-(4-bromophenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 294866-41-4) is a chemical compound with the molecular formula C10H10BrNO2S and a molecular weight of 288.16 g/mol. IUPAC name: (4R)-2-(4-bromophenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: TYLJHTCYCWHWRG-IENPIDJESA-N.
| Molecular formula | C10H10BrNO2S |
|---|---|
| Molecular weight | 288.16 g/mol |
| IUPAC name | (4R)-2-(4-bromophenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | TYLJHTCYCWHWRG-IENPIDJESA-N |
| SMILES | C1[C@H](NC(S1)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)