Products 1624260-49-6
CAS 1624260-49-6 is the registry number for S-(5-Bromo-2-formylphenyl) dimethylcarbamothioate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
S-(5-bromo-2-formylphenyl) N,N-dimethylcarbamothioate (CAS 1624260-49-6) is a chemical compound with the molecular formula C10H10BrNO2S and a molecular weight of 288.16 g/mol. IUPAC name: S-(5-bromo-2-formylphenyl) N,N-dimethylcarbamothioate. InChIKey: IPJVQSLXRVHCCR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2S |
|---|---|
| Molecular weight | 288.16 g/mol |
| IUPAC name | S-(5-bromo-2-formylphenyl) N,N-dimethylcarbamothioate |
| InChIKey | IPJVQSLXRVHCCR-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)SC1=C(C=CC(=C1)Br)C=O |
Computed by PubChem (NCBI)