Products 118721-56-5
CAS 118721-56-5 appears in our catalog under these names: 2-(3-Bromophenyl)-1,3-thiazolidine-4-carboxylic acid, 95%, 2-(3-Bromophenyl)-1,3-thiazolidine-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 250mg, 1g, 5g, 0,5g.
2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 118721-56-5) is a chemical compound with the molecular formula C10H10BrNO2S and a molecular weight of 288.16 g/mol. IUPAC name: 2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: LZVZEQCJORCGOK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2S |
|---|---|
| Molecular weight | 288.16 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | LZVZEQCJORCGOK-UHFFFAOYSA-N |
| SMILES | C1C(NC(S1)C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)