CAS 198707-57-2 appears in our catalog under these names: 3-(2,3-Dihydrobenzofuran-5-yl)acrylic acid, 98%, 98%, 3-(2,3-Dihydrobenzofuran-5-yl)-2-propenoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoic acid (CAS 198707-57-2) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoic acid. InChIKey: KNKNRFWCOVWKHJ-DUXPYHPUSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoic acid |
| InChIKey | KNKNRFWCOVWKHJ-DUXPYHPUSA-N |
| SMILES | C1COC2=C1C=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)