CAS 203505-84-4 appears in our catalog under these names: (E)–3–(2,3–Dihydrobenzofuran–5–yl)acrylic acid, 3-(2,3-Dihydro-1-benzofuran-5-yl)acrylic acid, (2E)-3-(2,3-DIHYDROBENZOFURAN-5-YL)PROPENOICACID, 95%, 95%, (2E)-3-(2,3-Dihydrobenzofuran-5-yl)propenoic acid, 95%, (E)-3-(2,3-Dihydrobenzofuran-5-yl)acrylic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 10g.
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoic acid (CAS 203505-84-4) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoic acid. InChIKey: KNKNRFWCOVWKHJ-DUXPYHPUSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoic acid |
| InChIKey | KNKNRFWCOVWKHJ-DUXPYHPUSA-N |
| SMILES | C1COC2=C1C=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)