CAS 1988083-25-5 is the registry number for 6-(Aminomethyl)pyridine-3-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-(aminomethyl)pyridine-3-carboxylic acid;dihydrochloride (CAS 1988083-25-5) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 6-(aminomethyl)pyridine-3-carboxylic acid;dihydrochloride. InChIKey: DQIQOSCYUZOZSO-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 6-(aminomethyl)pyridine-3-carboxylic acid;dihydrochloride |
| InChIKey | DQIQOSCYUZOZSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)CN.Cl.Cl |
Computed by PubChem (NCBI)