Products 199167-77-6
CAS 199167-77-6 is the registry number for Methyl 4-[(2,4-dioxo-5-thiazolidinylidene)methyl]benzoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoate (CAS 199167-77-6) is a chemical compound with the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. IUPAC name: methyl 4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoate. InChIKey: VVYFDUGNDSIVAM-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | methyl 4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]benzoate |
| InChIKey | VVYFDUGNDSIVAM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C=C2C(=O)NC(=O)S2 |
Computed by PubChem (NCBI)