CAS 1993179-21-7 is the registry number for 1-Phenylimidazo[1,5-a]pyridine-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-phenylimidazo[1,5-a]pyridine-3-carbaldehyde (CAS 1993179-21-7) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: 1-phenylimidazo[1,5-a]pyridine-3-carbaldehyde. InChIKey: AACIUVIXUXCQEO-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 1-phenylimidazo[1,5-a]pyridine-3-carbaldehyde |
| InChIKey | AACIUVIXUXCQEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CN3C(=N2)C=O |
Computed by PubChem (NCBI)