CAS 19968-55-9 is the registry number for 2,4-Dimethyl-5-phenyl-thiazol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2,4-dimethyl-5-phenyl-1,3-thiazole (CAS 19968-55-9) is a chemical compound with the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. IUPAC name: 2,4-dimethyl-5-phenyl-1,3-thiazole. InChIKey: BWJJRBGXBFRKCF-UHFFFAOYSA-N.
| Molecular formula | C11H11NS |
|---|---|
| Molecular weight | 189.28 g/mol |
| IUPAC name | 2,4-dimethyl-5-phenyl-1,3-thiazole |
| InChIKey | BWJJRBGXBFRKCF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)