CAS 19983-15-4 is the registry number for 2-Phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS 19983-15-4) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid. InChIKey: HOZQYTNELGLJMC-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| InChIKey | HOZQYTNELGLJMC-UHFFFAOYSA-N |
| SMILES | C1C(N=C(S1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)