Products 19983-15-4

CAS 19983-15-4 is the registry number for 2-Phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS 19983-15-4) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid. InChIKey: HOZQYTNELGLJMC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO2S
Molecular weight207.25 g/mol
IUPAC name2-phenyl-4,5-dihydro-1,3-thiazole-4-carboxylic acid
InChIKeyHOZQYTNELGLJMC-UHFFFAOYSA-N
SMILESC1C(N=C(S1)C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)