Products 1998513-62-4
CAS 1998513-62-4 appears in our catalog under these names: Fmoc-3-(4-Quinolyl)-L-Ala-OH, 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(quinolin-4-yl)propanoic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 100mg, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-4-ylpropanoic acid (CAS 1998513-62-4) is a chemical compound with the molecular formula C27H22N2O4 and a molecular weight of 438.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-4-ylpropanoic acid. InChIKey: UILNMPKRVDFFIU-VWLOTQADSA-N.
| Molecular formula | C27H22N2O4 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-quinolin-4-ylpropanoic acid |
| InChIKey | UILNMPKRVDFFIU-VWLOTQADSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=NC5=CC=CC=C45)C(=O)O |
Computed by PubChem (NCBI)