CAS 2002-75-7 appears in our catalog under these names: 2-Chloro-1-(5-fluoro-2-hydroxyphenyl)ethan-1-one, 95%, 2-Chloro-5'-fluoro-2'-hydroxy-acetophenone, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-1-(5-fluoro-2-hydroxyphenyl)ethanone (CAS 2002-75-7) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-chloro-1-(5-fluoro-2-hydroxyphenyl)ethanone. InChIKey: MXQGROLAGNLEHA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-chloro-1-(5-fluoro-2-hydroxyphenyl)ethanone |
| InChIKey | MXQGROLAGNLEHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)CCl)O |
Computed by PubChem (NCBI)