CAS 200289-73-2 is the registry number for 3-Bromo-6-methoxy-9H-carbazole, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
3-bromo-6-methoxy-9H-carbazole (CAS 200289-73-2) is a chemical compound with the molecular formula C13H10BrNO and a molecular weight of 276.13 g/mol. IUPAC name: 3-bromo-6-methoxy-9H-carbazole. InChIKey: ZRAKJPHJUNFJGY-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | 3-bromo-6-methoxy-9H-carbazole |
| InChIKey | ZRAKJPHJUNFJGY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)