CAS 2006278-20-0 appears in our catalog under these names: 2-(1-Benzyl-3-pyrazolyl)ethylamine dihydrochloride, 2-(1-Benzyl-3-pyrazolyl)ethylamine dihyd, rochloride, 1 g, 2-(1-Benzyl-3-pyrazolyl)ethylamine dihyd, rochloride, 2 g, 2-(1-Benzyl-3-pyrazolyl)ethylamine dihyd, rochloride, 5 g, 2-(1-Benzyl-3-pyrazolyl)ethylamine dihyd, rochloride, 10 g. Offered by: Biosynth, Roth. Available pack sizes: 2g, 1g, 5g, 10g.
2-(1-benzylpyrazol-3-yl)ethanamine;dihydrochloride (CAS 2006278-20-0) is a chemical compound with the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. IUPAC name: 2-(1-benzylpyrazol-3-yl)ethanamine;dihydrochloride. InChIKey: WPEQZWVZGHPFPP-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3 |
|---|---|
| Molecular weight | 274.19 g/mol |
| IUPAC name | 2-(1-benzylpyrazol-3-yl)ethanamine;dihydrochloride |
| InChIKey | WPEQZWVZGHPFPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC(=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)