CAS 200630-46-2 appears in our catalog under these names: 3-O-Methyl-L-DOPA Monohydrate, 3-O-methyl-L-DOPA (hydrate), 3–O–methyl–L–DOPA (hydrate), 3-O-Methyl L-DOPA monohydrate, (S)-2-Amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid hydrate, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 1mg, 5mg, 10mg, 0,05g, 0,03g.
(2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid;hydrate (CAS 200630-46-2) is a chemical compound with the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid;hydrate. InChIKey: IDRRCKUGGXLORG-FJXQXJEOSA-N.
| Molecular formula | C10H15NO5 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoic acid;hydrate |
| InChIKey | IDRRCKUGGXLORG-FJXQXJEOSA-N |
| SMILES | COC1=C(C=CC(=C1)C[C@@H](C(=O)O)N)O.O |
Computed by PubChem (NCBI)