Products 200709-36-0
CAS 200709-36-0 is the registry number for Apremilast Impurity 126. Offered by: Chemat Brand. Available pack sizes: on request.
3-acetamido-2-methoxycarbonylbenzoic acid (CAS 200709-36-0) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: 3-acetamido-2-methoxycarbonylbenzoic acid. InChIKey: ZNBLNLLINVDREQ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 3-acetamido-2-methoxycarbonylbenzoic acid |
| InChIKey | ZNBLNLLINVDREQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)