CAS 2007915-65-1 is the registry number for 4-(3,5-Dibromophenoxy)butanoic acid. Offered by: Biosynth. Available pack sizes: 5000mg.
4-(3,5-dibromophenoxy)butanoic acid (CAS 2007915-65-1) is a chemical compound with the molecular formula C10H10Br2O3 and a molecular weight of 337.99 g/mol. IUPAC name: 4-(3,5-dibromophenoxy)butanoic acid. InChIKey: SCPBAXIWNAWULX-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O3 |
|---|---|
| Molecular weight | 337.99 g/mol |
| IUPAC name | 4-(3,5-dibromophenoxy)butanoic acid |
| InChIKey | SCPBAXIWNAWULX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)OCCCC(=O)O |
Computed by PubChem (NCBI)