Products 201010-95-9
CAS 201010-95-9 appears in our catalog under these names: ER–27319, Er 27319 maleate, ER-27319, 98.66%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 1mg, 10mg, 50mg, 5 mg.
10-(3-aminopropyl)-3,4-dimethylacridin-9-one;oxalic acid (CAS 201010-95-9) is a chemical compound with the molecular formula C20H22N2O5 and a molecular weight of 370.4 g/mol. IUPAC name: 10-(3-aminopropyl)-3,4-dimethylacridin-9-one;oxalic acid. InChIKey: IIELZHYJYZBSGG-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 10-(3-aminopropyl)-3,4-dimethylacridin-9-one;oxalic acid |
| InChIKey | IIELZHYJYZBSGG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C3=CC=CC=C3N2CCCN)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)