Products 7762-61-0
CAS 7762-61-0 appears in our catalog under these names: Ac–Tyr–Phe–OH, Ac-Tyr-Phe-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 1000mg, 500mg, 2000mg.
(2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoic acid (CAS 7762-61-0) is a chemical compound with the molecular formula C20H22N2O5 and a molecular weight of 370.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoic acid. InChIKey: LMNISZPMTXRXKN-ROUUACIJSA-N.
| Molecular formula | C20H22N2O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | LMNISZPMTXRXKN-ROUUACIJSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)