CAS 21881-18-5 appears in our catalog under these names: Z–Phe–Ala–OH, Cbz-Phe-Ala-OH 95%, Z-Phe-Ala-OH, 95%, 95%, Z-Phe-Ala-OH, 96.0%, Z-Phe-Ala, 95%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 500 mg.
(2S)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 21881-18-5) is a chemical compound with the molecular formula C20H22N2O5 and a molecular weight of 370.4 g/mol. IUPAC name: (2S)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: LEJTXQOVOPDGHS-YOEHRIQHSA-N.
| Molecular formula | C20H22N2O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | LEJTXQOVOPDGHS-YOEHRIQHSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)